Sonzaschool
Rudi

Sekondari ya Juu · Kidato cha Tano

Advanced Mathematics 1

Factor Formulae

takriban dakika 6 kusoma

Majadiliano
Mada za sehemu hiiTrigonometryMada 7

Factor Formulae

Factor formulae are used to factorize the sum and difference of two trigonometric terms and to express a product as a sum or difference. They are derived from the compound angle formulae.

Derivation of factor formulae

From the compound angle formulae for sine:

sin(A+B)=sinAcosB+cosAsinB\sin(A + B) = \sin A \cos B + \cos A \sin B

sin(AB)=sinAcosBcosAsinB\sin(A - B) = \sin A \cos B - \cos A \sin B

Adding the two equations gives:

sin(A+B)+sin(AB)=2sinAcosB(i)\sin(A + B) + \sin(A - B) = 2\sin A \cos B \quad \text{(i)}

Subtracting the two equations gives:

sin(A+B)sin(AB)=2cosAsinB(ii)\sin(A + B) - \sin(A - B) = 2\cos A \sin B \quad \text{(ii)}

From the compound angle formulae for cosine:

cos(A+B)=cosAcosBsinAsinB\cos(A + B) = \cos A \cos B - \sin A \sin B

cos(AB)=cosAcosB+sinAsinB\cos(A - B) = \cos A \cos B + \sin A \sin B

Adding the two equations gives:

cos(A+B)+cos(AB)=2cosAcosB(iii)\cos(A + B) + \cos(A - B) = 2\cos A \cos B \quad \text{(iii)}

Subtracting the two equations gives:

cos(AB)cos(A+B)=2sinAsinB(iv)\cos(A - B) - \cos(A + B) = 2\sin A \sin B \quad \text{(iv)}

Let P=A+BP = A + B and Q=ABQ = A - B. Then:

P+Q=2A, so A=P+Q2P + Q = 2A, \text{ so } A = \frac{P + Q}{2}

PQ=2B, so B=PQ2P - Q = 2B, \text{ so } B = \frac{P - Q}{2}

Substituting these into equations (i), (ii), (iii), and (iv) gives the factor formulae:

sinP+sinQ=2sin(P+Q2)cos(PQ2)(7.8)\sin P + \sin Q = 2\sin\left(\frac{P + Q}{2}\right)\cos\left(\frac{P - Q}{2}\right) \quad (7.8)

sinPsinQ=2cos(P+Q2)sin(PQ2)(7.9)\sin P - \sin Q = 2\cos\left(\frac{P + Q}{2}\right)\sin\left(\frac{P - Q}{2}\right) \quad (7.9)

cosP+cosQ=2cos(P+Q2)cos(PQ2)(7.10)\cos P + \cos Q = 2\cos\left(\frac{P + Q}{2}\right)\cos\left(\frac{P - Q}{2}\right) \quad (7.10)

cosQcosP=2sin(P+Q2)sin(PQ2)(7.11)\cos Q - \cos P = 2\sin\left(\frac{P + Q}{2}\right)\sin\left(\frac{P - Q}{2}\right) \quad (7.11)

Note the change in sign and order in this formula compared to the source material.

Example 1

Prove that sinθ+sin2θ+sin3θ=sin2θ(2cosθ+1)\sin\theta + \sin 2\theta + \sin 3\theta = \sin 2\theta(2\cos\theta + 1).

Solution:

Consider the left-hand side:

sinθ+sin2θ+sin3θ=(sin3θ+sinθ)+sin2θ\sin\theta + \sin 2\theta + \sin 3\theta = (\sin 3\theta + \sin\theta) + \sin 2\theta

=2sin(3θ+θ2)cos(3θθ2)+sin2θ= 2\sin\left(\frac{3\theta + \theta}{2}\right)\cos\left(\frac{3\theta - \theta}{2}\right) + \sin 2\theta

=2sin2θcosθ+sin2θ= 2\sin 2\theta \cos\theta + \sin 2\theta

=sin2θ(2cosθ+1)= \sin 2\theta(2\cos\theta + 1)

Therefore, sinθ+sin2θ+sin3θ=sin2θ(2cosθ+1)\sin\theta + \sin 2\theta + \sin 3\theta = \sin 2\theta(2\cos\theta + 1).

Example 2

In any triangle ABC, prove that sinA+sinB+sinC=4cosA2cosB2cosC2\sin A + \sin B + \sin C = 4\cos\frac{A}{2}\cos\frac{B}{2}\cos\frac{C}{2}.

Solution:

Consider the left-hand side:

sinA+sinB+sinC=2sin(A+B2)cos(AB2)+sinC\sin A + \sin B + \sin C = 2\sin\left(\frac{A + B}{2}\right)\cos\left(\frac{A - B}{2}\right) + \sin C

Since A+B+C=180A + B + C = 180^\circ, then A+B2=90C2\frac{A + B}{2} = 90^\circ - \frac{C}{2}, and sin(A+B2)=cos(C2)\sin\left(\frac{A+B}{2}\right) = \cos\left(\frac{C}{2}\right)

=2cosC2cos(AB2)+2sinC2cosC2= 2\cos\frac{C}{2}\cos\left(\frac{A - B}{2}\right) + 2\sin\frac{C}{2}\cos\frac{C}{2}

=2cosC2[cos(AB2)+sinC2]= 2\cos\frac{C}{2}\left[\cos\left(\frac{A - B}{2}\right) + \sin\frac{C}{2}\right]

=2cosC2[cos(AB2)+cos(A+B2)]= 2\cos\frac{C}{2}\left[\cos\left(\frac{A - B}{2}\right) + \cos\left(\frac{A+B}{2}\right)\right]

=2cosC2[2cos(AB2+A+B22)cos(AB2A+B22)]= 2\cos\frac{C}{2}\left[2\cos\left(\frac{\frac{A-B}{2} + \frac{A+B}{2}}{2}\right)\cos\left(\frac{\frac{A-B}{2} - \frac{A+B}{2}}{2}\right)\right]

=4cosC2cosA2cosB2= 4\cos\frac{C}{2}\cos\frac{A}{2}\cos\frac{-B}{2}

=4cosA2cosB2cosC2= 4\cos\frac{A}{2}\cos\frac{B}{2}\cos\frac{C}{2}

Therefore, sinA+sinB+sinC=4cosA2cosB2cosC2\sin A + \sin B + \sin C = 4\cos\frac{A}{2}\cos\frac{B}{2}\cos\frac{C}{2}.

Example 3

Use the t-formulae to find the general solution of the equation 2cosxsinx=12\cos x - \sin x = 1, giving the answers in radians.

Solution:

Using the t-formulae, where t=tanx2t = \tan\frac{x}{2}:

2(1t21+t2)2t1+t2=12\left(\frac{1 - t^2}{1 + t^2}\right) - \frac{2t}{1 + t^2} = 1

22t22t=1+t22 - 2t^2 - 2t = 1 + t^2

3t2+2t1=03t^2 + 2t - 1 = 0

(3t1)(t+1)=0(3t - 1)(t + 1) = 0

t=13 or t=1t = \frac{1}{3} \text{ or } t = -1

Case 1: tanx2=13\tan\frac{x}{2} = \frac{1}{3}

x2=arctan(13)+nπ, where n is an integer.\frac{x}{2} = \arctan\left(\frac{1}{3}\right) + n\pi, \text{ where } n \text{ is an integer.}

x=2arctan(13)+2nπ0.6435+2nπx = 2\arctan\left(\frac{1}{3}\right) + 2n\pi \approx 0.6435 + 2n\pi

Case 2: tanx2=1\tan\frac{x}{2} = -1

x2=π4+nπ, where n is an integer.\frac{x}{2} = -\frac{\pi}{4} + n\pi, \text{ where } n \text{ is an integer.}

x=π2+2nπx = -\frac{\pi}{2} + 2n\pi

Therefore, the general solutions are x0.6435+2nπx \approx 0.6435 + 2n\pi and x=π2+2nπx = -\frac{\pi}{2} + 2n\pi, where nn is an integer.

To be more explicit and cover all possible solutions within a given range (e.g., 0 to 2π2\pi), you would substitute integer values for n. For instance:

For Case 1:

  • If n = 0: x0.6435x \approx 0.6435
  • If n = 1: x0.6435+2π6.9267x \approx 0.6435 + 2\pi \approx 6.9267 (This is outside the range 0 to 2π2\pi, so we generally don't include it unless the range is specified differently.)

For Case 2:

  • If n = 0: x=π21.5708x = -\frac{\pi}{2} \approx -1.5708 (This is outside the standard 0 to 2π2\pi range. To get the equivalent within that range, add 2π2\pi: 1.5708+2π4.7124-1.5708 + 2\pi \approx 4.7124)
  • If n = 1: x=π2+2π=3π24.7124x = -\frac{\pi}{2} + 2\pi = \frac{3\pi}{2} \approx 4.7124

So, within the range 0 to 2π2\pi, the solutions are approximately 0.6435 and 4.7124 radians.

Example 4

Simplify sinθ+sin3θ+sin5θcosθ+cos3θ+cos5θ\frac{\sin\theta + \sin 3\theta + \sin 5\theta}{\cos\theta + \cos 3\theta + \cos 5\theta}.

Solution:

sinθ+sin3θ+sin5θcosθ+cos3θ+cos5θ=(sin5θ+sinθ)+sin3θ(cos5θ+cosθ)+cos3θ\frac{\sin\theta + \sin 3\theta + \sin 5\theta}{\cos\theta + \cos 3\theta + \cos 5\theta} = \frac{(\sin 5\theta + \sin\theta) + \sin 3\theta}{(\cos 5\theta + \cos\theta) + \cos 3\theta}

=2sin(5θ+θ2)cos(5θθ2)+sin3θ2cos(5θ+θ2)cos(5θθ2)+cos3θ= \frac{2\sin\left(\frac{5\theta + \theta}{2}\right)\cos\left(\frac{5\theta - \theta}{2}\right) + \sin 3\theta}{2\cos\left(\frac{5\theta + \theta}{2}\right)\cos\left(\frac{5\theta - \theta}{2}\right) + \cos 3\theta}

=2sin3θcos2θ+sin3θ2cos3θcos2θ+cos3θ= \frac{2\sin 3\theta \cos 2\theta + \sin 3\theta}{2\cos 3\theta \cos 2\theta + \cos 3\theta}

=sin3θ(2cos2θ+1)cos3θ(2cos2θ+1)= \frac{\sin 3\theta(2\cos 2\theta + 1)}{\cos 3\theta(2\cos 2\theta + 1)}

=sin3θcos3θ= \frac{\sin 3\theta}{\cos 3\theta}

=tan3θ= \tan 3\theta

Example 5

Simplify tan(AB2)+tan(A+B2)1tan(AB2)tan(A+B2)\frac{\tan\left(\frac{A - B}{2}\right) + \tan\left(\frac{A + B}{2}\right)}{1 - \tan\left(\frac{A - B}{2}\right)\tan\left(\frac{A + B}{2}\right)}.

Solution:

Using the tangent addition formula: tan(x+y)=tanx+tany1tanxtany\tan(x + y) = \frac{\tan x + \tan y}{1 - \tan x \tan y}

Let x=AB2x = \frac{A - B}{2} and y=A+B2y = \frac{A + B}{2}

Then x+y=AB2+A+B2=Ax + y = \frac{A - B}{2} + \frac{A + B}{2} = A

So, the given expression becomes:

tan(AB2+A+B2)=tanA\tan\left(\frac{A - B}{2} + \frac{A + B}{2}\right) = \tan A

Example 6

Solve the equation cos5x+cosx=cos3x\cos 5x + \cos x = \cos 3x for 0xπ0 \le x \le \pi, giving the answer in terms of π\pi.

Solution:

cos5x+cosx=cos3x\cos 5x + \cos x = \cos 3x

2cos(5x+x2)cos(5xx2)=cos3x2\cos\left(\frac{5x + x}{2}\right)\cos\left(\frac{5x - x}{2}\right) = \cos 3x

2cos3xcos2x=cos3x2\cos 3x \cos 2x = \cos 3x

2cos3xcos2xcos3x=02\cos 3x \cos 2x - \cos 3x = 0

cos3x(2cos2x1)=0\cos 3x(2\cos 2x - 1) = 0

Case 1: cos3x=0\cos 3x = 0

3x=π2,3π2,5π23x = \frac{\pi}{2}, \frac{3\pi}{2}, \frac{5\pi}{2}

x=π6,π2,5π6x = \frac{\pi}{6}, \frac{\pi}{2}, \frac{5\pi}{6}

Case 2: 2cos2x1=02\cos 2x - 1 = 0

cos2x=12\cos 2x = \frac{1}{2}

2x=π3,5π32x = \frac{\pi}{3}, \frac{5\pi}{3}

x=π6,5π6x = \frac{\pi}{6}, \frac{5\pi}{6}

Combining the solutions, we have x=π6,π2,5π6x = \frac{\pi}{6}, \frac{\pi}{2}, \frac{5\pi}{6}.

Mwalimu

Unasoma somo hili? Niulize nikuelezee chochote kilichomo.

Ingia ili kumuuliza Mwalimu wa AI wa Sonza kuhusu mada hii.

Ingia ili kuuliza

Majadiliano

Hakuna maswali bado

Ingia ili kuuliza
Inapakia majadiliano…